C60H51BN2O2 — CID 66797840
5-[4-[4-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)phenyl]phenyl]-7,7-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indeno[2,1-b]carbazole (PubChem CID 66797840) has the molecular formula C60H51BN2O2 and a molecular weight of 842.89 g/mol. Its IUPAC name is 5-[4-[4-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)phenyl]phenyl]-7,7-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indeno[2,1-b]carbazole.
| Compound Name | 5-[4-[4-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)phenyl]phenyl]-7,7-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 66797840 |
| Molecular Formula | C60H51BN2O2 |
| Molecular Weight | 842.89 g/mol |
| Exact Mass | 842.40 |
| IUPAC Name | 5-[4-[4-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)phenyl]phenyl]-7,7-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indeno[2,1-b]carbazole |
| SMILES | CC1(C)c2ccccc2-c2cc3c4ccccc4n(-c4ccc(-c5ccc(-n6c7ccc(B8OC(C)(C)C(C)(C)O8)cc7c7cc8c(cc76)C(C)(C)c6ccccc6-8)cc5)cc4)c3cc21 |
| InChI | InChI=1S/C60H51BN2O2/c1-57(2)49-18-12-9-15-41(49)44-32-47-43-17-11-14-20-53(43)62(55(47)34-51(44)57)39-26-21-36(22-27-39)37-23-28-40(29-24-37)63-54-30-25-38(61-64-59(5,6)60(7,8)65-61)31-46(54)48-33-45-42-16-10-13-19-50(42)58(3,4)52(45)35-56(48)63/h9-35H,1-8H3 |
| InChIKey | NDTZQZUVMIEUQI-UHFFFAOYSA-N |
| XLogP | 14.46 |
| TPSA | 28.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.89 |
| LogP ≤ 5 | 14.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|