C36H25BrN4 — CID 66797951
2-bromo-5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,7-dimethylindeno[2,1-b]carbazole (PubChem CID 66797951) has the molecular formula C36H25BrN4 and a molecular weight of 593.53 g/mol. Its IUPAC name is 2-bromo-5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,7-dimethylindeno[2,1-b]carbazole.
| Compound Name | 2-bromo-5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,7-dimethylindeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 66797951 |
| Molecular Formula | C36H25BrN4 |
| Molecular Weight | 593.53 g/mol |
| Exact Mass | 592.13 |
| IUPAC Name | 2-bromo-5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,7-dimethylindeno[2,1-b]carbazole |
| SMILES | CC1(C)c2ccccc2-c2cc3c4cc(Br)ccc4n(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3cc21 |
| InChI | InChI=1S/C36H25BrN4/c1-36(2)29-16-10-9-15-25(29)26-20-28-27-19-24(37)17-18-31(27)41(32(28)21-30(26)36)35-39-33(22-11-5-3-6-12-22)38-34(40-35)23-13-7-4-8-14-23/h3-21H,1-2H3 |
| InChIKey | PARQPRHOASBGHV-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.53 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |