C42H37BN4O2 — CID 66797982
5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,7-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indeno[2,1-b]carbazole (PubChem CID 66797982) has the molecular formula C42H37BN4O2 and a molecular weight of 640.60 g/mol. Its IUPAC name is 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,7-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indeno[2,1-b]carbazole.
| Compound Name | 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,7-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 66797982 |
| Molecular Formula | C42H37BN4O2 |
| Molecular Weight | 640.60 g/mol |
| Exact Mass | 640.30 |
| IUPAC Name | 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,7-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indeno[2,1-b]carbazole |
| SMILES | CC1(C)c2ccccc2-c2cc3c4cc(B5OC(C)(C)C(C)(C)O5)ccc4n(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3cc21 |
| InChI | InChI=1S/C42H37BN4O2/c1-40(2)33-20-14-13-19-29(33)30-24-32-31-23-28(43-48-41(3,4)42(5,6)49-43)21-22-35(31)47(36(32)25-34(30)40)39-45-37(26-15-9-7-10-16-26)44-38(46-39)27-17-11-8-12-18-27/h7-25H,1-6H3 |
| InChIKey | ZDRWBGFIKPDTTJ-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.60 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|