C32H54N4O3Si2 — CID 66798205
4-N-[(1R,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopentyl]-2-[(1R,2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-diamine (PubChem CID 66798205) has the molecular formula C32H54N4O3Si2 and a molecular weight of 598.98 g/mol. Its IUPAC name is 4-N-[(1R,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopentyl]-2-[(1R,2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-diamine.
| Compound Name | 4-N-[(1R,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopentyl]-2-[(1R,2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 66798205 |
| Molecular Formula | C32H54N4O3Si2 |
| Molecular Weight | 598.98 g/mol |
| Exact Mass | 598.37 |
| IUPAC Name | 4-N-[(1R,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopentyl]-2-[(1R,2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-diamine |
| SMILES | CO[C@H]1Cc2ccccc2[C@@H]1c1nc(N)cc(N[C@@H]2C[C@@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C2)n1 |
| InChI | InChI=1S/C32H54N4O3Si2/c1-31(2,3)40(8,9)38-20-22-16-23(18-25(22)39-41(10,11)32(4,5)6)34-28-19-27(33)35-30(36-28)29-24-15-13-12-14-21(24)17-26(29)37-7/h12-15,19,22-23,25-26,29H,16-18,20H2,1-11H3,(H3,33,34,35,36)/t22-,23+,25-,26-,29-/m0/s1 |
| InChIKey | RRUGXEBDKMEWIQ-BTCYMDFISA-N |
| XLogP | 7.36 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.98 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|