About 1-cyclopentyl-2-[1-(1,3-difluoropropan-2-yl)-2H-pyridin-2-yl]indole-3,6-dicarbonitrile
1-cyclopentyl-2-[1-(1,3-difluoropropan-2-yl)-2H-pyridin-2-yl]indole-3,6-dicarbonitrile (PubChem CID 66798234) has the molecular formula C23H22F2N4
and a molecular weight of 392.45 g/mol. Its IUPAC name is 1-cyclopentyl-2-[1-(1,3-difluoropropan-2-yl)-2H-pyridin-2-yl]indole-3,6-dicarbonitrile.
Molecular Properties
| Compound Name | 1-cyclopentyl-2-[1-(1,3-difluoropropan-2-yl)-2H-pyridin-2-yl]indole-3,6-dicarbonitrile |
| PubChem CID | 66798234 |
| Molecular Formula | C23H22F2N4 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 1-cyclopentyl-2-[1-(1,3-difluoropropan-2-yl)-2H-pyridin-2-yl]indole-3,6-dicarbonitrile |
| SMILES | N#Cc1ccc2c(C#N)c(C3C=CC=CN3C(CF)CF)n(C3CCCC3)c2c1 |
| InChI | InChI=1S/C23H22F2N4/c24-12-18(13-25)28-10-4-3-7-21(28)23-20(15-27)19-9-8-16(14-26)11-22(19)29(23)17-5-1-2-6-17/h3-4,7-11,17-18,21H,1-2,5-6,12-13H2 |
| InChIKey | QCPDDDXYBIRDMR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 55.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cyclopentyl-2-[1-(1,3-difluoropropan-2-yl)-2H-pyridin-2-yl]indole-3,6-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-2-[1-(1,3-difluoropropan-2-yl)-2H-pyridin-2-yl]indole-3,6-dicarbonitrile?
The IUPAC name of 1-cyclopentyl-2-[1-(1,3-difluoropropan-2-yl)-2H-pyridin-2-yl]indole-3,6-dicarbonitrile (CID 66798234) is 1-cyclopentyl-2-[1-(1,3-difluoropropan-2-yl)-2H-pyridin-2-yl]indole-3,6-dicarbonitrile.
What is the SMILES notation for 1-cyclopentyl-2-[1-(1,3-difluoropropan-2-yl)-2H-pyridin-2-yl]indole-3,6-dicarbonitrile?
The canonical SMILES for 1-cyclopentyl-2-[1-(1,3-difluoropropan-2-yl)-2H-pyridin-2-yl]indole-3,6-dicarbonitrile is N#Cc1ccc2c(C#N)c(C3C=CC=CN3C(CF)CF)n(C3CCCC3)c2c1.
What is the InChIKey of 1-cyclopentyl-2-[1-(1,3-difluoropropan-2-yl)-2H-pyridin-2-yl]indole-3,6-dicarbonitrile?
The InChIKey is QCPDDDXYBIRDMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22F2N4/c24-12-18(13-25)28-10-4-3-7-21(28)23-20(15-27)19-9-8-16(14-26)11-22(19)29(23)17-5-1-2-6-17/h3-4,7-11,17-18,21H,1-2,5-6,12-13H2.
What are the key properties of 1-cyclopentyl-2-[1-(1,3-difluoropropan-2-yl)-2H-pyridin-2-yl]indole-3,6-dicarbonitrile?
1-cyclopentyl-2-[1-(1,3-difluoropropan-2-yl)-2H-pyridin-2-yl]indole-3,6-dicarbonitrile has a molecular weight of 392.45 g/mol, XLogP of 5.23, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-2-[1-(1,3-difluoropropan-2-yl)-2H-pyridin-2-yl]indole-3,6-dicarbonitrile is sourced from PubChem (CID 66798234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).