About N-(3,7-dimethylocta-2,6-dienyl)cyclopropanecarboxamide
N-(3,7-dimethylocta-2,6-dienyl)cyclopropanecarboxamide (PubChem CID 66799595) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is N-(3,7-dimethylocta-2,6-dienyl)cyclopropanecarboxamide.
Molecular Properties
| Compound Name | N-(3,7-dimethylocta-2,6-dienyl)cyclopropanecarboxamide |
| PubChem CID | 66799595 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | N-(3,7-dimethylocta-2,6-dienyl)cyclopropanecarboxamide |
| SMILES | CC(C)=CCCC(C)=CCNC(=O)C1CC1 |
| InChI | InChI=1S/C14H23NO/c1-11(2)5-4-6-12(3)9-10-15-14(16)13-7-8-13/h5,9,13H,4,6-8,10H2,1-3H3,(H,15,16) |
| InChIKey | UKNMSFRSBQONET-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(3,7-dimethylocta-2,6-dienyl)cyclopropanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,7-dimethylocta-2,6-dienyl)cyclopropanecarboxamide?
The IUPAC name of N-(3,7-dimethylocta-2,6-dienyl)cyclopropanecarboxamide (CID 66799595) is N-(3,7-dimethylocta-2,6-dienyl)cyclopropanecarboxamide.
What is the SMILES notation for N-(3,7-dimethylocta-2,6-dienyl)cyclopropanecarboxamide?
The canonical SMILES for N-(3,7-dimethylocta-2,6-dienyl)cyclopropanecarboxamide is CC(C)=CCCC(C)=CCNC(=O)C1CC1.
What is the InChIKey of N-(3,7-dimethylocta-2,6-dienyl)cyclopropanecarboxamide?
The InChIKey is UKNMSFRSBQONET-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO/c1-11(2)5-4-6-12(3)9-10-15-14(16)13-7-8-13/h5,9,13H,4,6-8,10H2,1-3H3,(H,15,16).
What are the key properties of N-(3,7-dimethylocta-2,6-dienyl)cyclopropanecarboxamide?
N-(3,7-dimethylocta-2,6-dienyl)cyclopropanecarboxamide has a molecular weight of 221.34 g/mol, XLogP of 3.21, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,7-dimethylocta-2,6-dienyl)cyclopropanecarboxamide is sourced from PubChem (CID 66799595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).