C27H23FN2O3 — CID 66799658
3-[4-[(Z)-2-(2-fluoro-4-methoxyphenyl)-1-(1H-indazol-5-yl)but-1-enyl]phenyl]prop-2-enoic acid (PubChem CID 66799658) has the molecular formula C27H23FN2O3 and a molecular weight of 442.49 g/mol. Its IUPAC name is 3-[4-[(Z)-2-(2-fluoro-4-methoxyphenyl)-1-(1H-indazol-5-yl)but-1-enyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[(Z)-2-(2-fluoro-4-methoxyphenyl)-1-(1H-indazol-5-yl)but-1-enyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66799658 |
| Molecular Formula | C27H23FN2O3 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 3-[4-[(Z)-2-(2-fluoro-4-methoxyphenyl)-1-(1H-indazol-5-yl)but-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | CC/C(=C(\c1ccc(C=CC(=O)O)cc1)c1ccc2[nH]ncc2c1)c1ccc(OC)cc1F |
| InChI | InChI=1S/C27H23FN2O3/c1-3-22(23-11-10-21(33-2)15-24(23)28)27(19-9-12-25-20(14-19)16-29-30-25)18-7-4-17(5-8-18)6-13-26(31)32/h4-16H,3H2,1-2H3,(H,29,30)(H,31,32)/b13-6?,27-22- |
| InChIKey | BGQVEMPWNIWCSU-HROVPKQBSA-N |
| XLogP | 6.18 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|