About N-[(2-ethyl-2-azabicyclo[2.1.1]hexan-1-yl)-phenylmethyl]-2,6-dimethylbenzamide
N-[(2-ethyl-2-azabicyclo[2.1.1]hexan-1-yl)-phenylmethyl]-2,6-dimethylbenzamide (PubChem CID 66799677) has the molecular formula C23H28N2O
and a molecular weight of 348.49 g/mol. Its IUPAC name is N-[(2-ethyl-2-azabicyclo[2.1.1]hexan-1-yl)-phenylmethyl]-2,6-dimethylbenzamide.
Molecular Properties
| Compound Name | N-[(2-ethyl-2-azabicyclo[2.1.1]hexan-1-yl)-phenylmethyl]-2,6-dimethylbenzamide |
| PubChem CID | 66799677 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | N-[(2-ethyl-2-azabicyclo[2.1.1]hexan-1-yl)-phenylmethyl]-2,6-dimethylbenzamide |
| SMILES | CCN1CC2CC1(C(NC(=O)c1c(C)cccc1C)c1ccccc1)C2 |
| InChI | InChI=1S/C23H28N2O/c1-4-25-15-18-13-23(25,14-18)21(19-11-6-5-7-12-19)24-22(26)20-16(2)9-8-10-17(20)3/h5-12,18,21H,4,13-15H2,1-3H3,(H,24,26) |
| InChIKey | CRHBNKXKYWDCGB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(2-ethyl-2-azabicyclo[2.1.1]hexan-1-yl)-phenylmethyl]-2,6-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-ethyl-2-azabicyclo[2.1.1]hexan-1-yl)-phenylmethyl]-2,6-dimethylbenzamide?
The IUPAC name of N-[(2-ethyl-2-azabicyclo[2.1.1]hexan-1-yl)-phenylmethyl]-2,6-dimethylbenzamide (CID 66799677) is N-[(2-ethyl-2-azabicyclo[2.1.1]hexan-1-yl)-phenylmethyl]-2,6-dimethylbenzamide.
What is the SMILES notation for N-[(2-ethyl-2-azabicyclo[2.1.1]hexan-1-yl)-phenylmethyl]-2,6-dimethylbenzamide?
The canonical SMILES for N-[(2-ethyl-2-azabicyclo[2.1.1]hexan-1-yl)-phenylmethyl]-2,6-dimethylbenzamide is CCN1CC2CC1(C(NC(=O)c1c(C)cccc1C)c1ccccc1)C2.
What is the InChIKey of N-[(2-ethyl-2-azabicyclo[2.1.1]hexan-1-yl)-phenylmethyl]-2,6-dimethylbenzamide?
The InChIKey is CRHBNKXKYWDCGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N2O/c1-4-25-15-18-13-23(25,14-18)21(19-11-6-5-7-12-19)24-22(26)20-16(2)9-8-10-17(20)3/h5-12,18,21H,4,13-15H2,1-3H3,(H,24,26).
What are the key properties of N-[(2-ethyl-2-azabicyclo[2.1.1]hexan-1-yl)-phenylmethyl]-2,6-dimethylbenzamide?
N-[(2-ethyl-2-azabicyclo[2.1.1]hexan-1-yl)-phenylmethyl]-2,6-dimethylbenzamide has a molecular weight of 348.49 g/mol, XLogP of 4.26, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-ethyl-2-azabicyclo[2.1.1]hexan-1-yl)-phenylmethyl]-2,6-dimethylbenzamide is sourced from PubChem (CID 66799677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).