About 3-[[5-chloro-4-(2,5-difluorophenyl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid
3-[[5-chloro-4-(2,5-difluorophenyl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid (PubChem CID 66799807) has the molecular formula C17H10ClF2NO5S2
and a molecular weight of 445.85 g/mol. Its IUPAC name is 3-[[5-chloro-4-(2,5-difluorophenyl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid.
Molecular Properties
| Compound Name | 3-[[5-chloro-4-(2,5-difluorophenyl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid |
| PubChem CID | 66799807 |
| Molecular Formula | C17H10ClF2NO5S2 |
| Molecular Weight | 445.85 g/mol |
| Exact Mass | 444.97 |
| IUPAC Name | 3-[[5-chloro-4-(2,5-difluorophenyl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cccc(NS(=O)(=O)c2cc(-c3cc(F)ccc3F)c(Cl)s2)c1O |
| InChI | InChI=1S/C17H10ClF2NO5S2/c18-16-11(10-6-8(19)4-5-12(10)20)7-14(27-16)28(25,26)21-13-3-1-2-9(15(13)22)17(23)24/h1-7,21-22H,(H,23,24) |
| InChIKey | ZCLSRXDKDSCJIV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.85 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 3-[[5-chloro-4-(2,5-difluorophenyl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[5-chloro-4-(2,5-difluorophenyl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid?
The IUPAC name of 3-[[5-chloro-4-(2,5-difluorophenyl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid (CID 66799807) is 3-[[5-chloro-4-(2,5-difluorophenyl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid.
What is the SMILES notation for 3-[[5-chloro-4-(2,5-difluorophenyl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid?
The canonical SMILES for 3-[[5-chloro-4-(2,5-difluorophenyl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid is O=C(O)c1cccc(NS(=O)(=O)c2cc(-c3cc(F)ccc3F)c(Cl)s2)c1O.
What is the InChIKey of 3-[[5-chloro-4-(2,5-difluorophenyl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid?
The InChIKey is ZCLSRXDKDSCJIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10ClF2NO5S2/c18-16-11(10-6-8(19)4-5-12(10)20)7-14(27-16)28(25,26)21-13-3-1-2-9(15(13)22)17(23)24/h1-7,21-22H,(H,23,24).
What are the key properties of 3-[[5-chloro-4-(2,5-difluorophenyl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid?
3-[[5-chloro-4-(2,5-difluorophenyl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid has a molecular weight of 445.85 g/mol, XLogP of 4.55, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[5-chloro-4-(2,5-difluorophenyl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid is sourced from PubChem (CID 66799807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).