About 2-chloro-3-(2,5-difluorophenyl)thiophene
2-chloro-3-(2,5-difluorophenyl)thiophene (PubChem CID 66799983) has the molecular formula C10H5ClF2S
and a molecular weight of 230.67 g/mol. Its IUPAC name is 2-chloro-3-(2,5-difluorophenyl)thiophene.
Molecular Properties
| Compound Name | 2-chloro-3-(2,5-difluorophenyl)thiophene |
| PubChem CID | 66799983 |
| Molecular Formula | C10H5ClF2S |
| Molecular Weight | 230.67 g/mol |
| Exact Mass | 229.98 |
| IUPAC Name | 2-chloro-3-(2,5-difluorophenyl)thiophene |
| SMILES | Fc1ccc(F)c(-c2ccsc2Cl)c1 |
| InChI | InChI=1S/C10H5ClF2S/c11-10-7(3-4-14-10)8-5-6(12)1-2-9(8)13/h1-5H |
| InChIKey | YQWHHLQIUABNBI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.67 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-chloro-3-(2,5-difluorophenyl)thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-(2,5-difluorophenyl)thiophene?
The IUPAC name of 2-chloro-3-(2,5-difluorophenyl)thiophene (CID 66799983) is 2-chloro-3-(2,5-difluorophenyl)thiophene.
What is the SMILES notation for 2-chloro-3-(2,5-difluorophenyl)thiophene?
The canonical SMILES for 2-chloro-3-(2,5-difluorophenyl)thiophene is Fc1ccc(F)c(-c2ccsc2Cl)c1.
What is the InChIKey of 2-chloro-3-(2,5-difluorophenyl)thiophene?
The InChIKey is YQWHHLQIUABNBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5ClF2S/c11-10-7(3-4-14-10)8-5-6(12)1-2-9(8)13/h1-5H.
What are the key properties of 2-chloro-3-(2,5-difluorophenyl)thiophene?
2-chloro-3-(2,5-difluorophenyl)thiophene has a molecular weight of 230.67 g/mol, XLogP of 4.35, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-(2,5-difluorophenyl)thiophene is sourced from PubChem (CID 66799983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).