C10H5ClF2S — CID 66799983
2-chloro-3-(2,5-difluorophenyl)thiophene (PubChem CID 66799983) has the molecular formula C10H5ClF2S and a molecular weight of 230.67 g/mol. Its IUPAC name is 2-chloro-3-(2,5-difluorophenyl)thiophene.
| Compound Name | 2-chloro-3-(2,5-difluorophenyl)thiophene |
|---|---|
| PubChem CID | 66799983 |
| Molecular Formula | C10H5ClF2S |
| Molecular Weight | 230.67 g/mol |
| Exact Mass | 229.98 |
| IUPAC Name | 2-chloro-3-(2,5-difluorophenyl)thiophene |
| SMILES | Fc1ccc(F)c(-c2ccsc2Cl)c1 |
| InChI | InChI=1S/C10H5ClF2S/c11-10-7(3-4-14-10)8-5-6(12)1-2-9(8)13/h1-5H |
| InChIKey | YQWHHLQIUABNBI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.67 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |