C8H16N2O — CID 66800126
(4aS,7aR)-3,3-dimethyl-2,4,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine (PubChem CID 66800126) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is (4aS,7aR)-3,3-dimethyl-2,4,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine.
| Compound Name | (4aS,7aR)-3,3-dimethyl-2,4,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine |
|---|---|
| PubChem CID | 66800126 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | (4aS,7aR)-3,3-dimethyl-2,4,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine |
| SMILES | CC1(C)CN[C@H]2COC[C@H]2N1 |
| InChI | InChI=1S/C8H16N2O/c1-8(2)5-9-6-3-11-4-7(6)10-8/h6-7,9-10H,3-5H2,1-2H3/t6-,7+/m0/s1 |
| InChIKey | KXELYGIPBXYGKB-NKWVEPMBSA-N |
| XLogP | -0.27 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |