C18H27ClN2 — CID 66800230
1-tert-butyl-4-(4-chlorophenyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline (PubChem CID 66800230) has the molecular formula C18H27ClN2 and a molecular weight of 306.88 g/mol. Its IUPAC name is 1-tert-butyl-4-(4-chlorophenyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline.
| Compound Name | 1-tert-butyl-4-(4-chlorophenyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline |
|---|---|
| PubChem CID | 66800230 |
| Molecular Formula | C18H27ClN2 |
| Molecular Weight | 306.88 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 1-tert-butyl-4-(4-chlorophenyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline |
| SMILES | CC(C)(C)N1CCN(c2ccc(Cl)cc2)C2CCCCC21 |
| InChI | InChI=1S/C18H27ClN2/c1-18(2,3)21-13-12-20(15-10-8-14(19)9-11-15)16-6-4-5-7-17(16)21/h8-11,16-17H,4-7,12-13H2,1-3H3 |
| InChIKey | OORWSALYLMLZAE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.88 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |