C10H16N2O — CID 66800391
(4aS)-3,3-dimethyl-1,4,4a,5,6,7-hexahydroquinoxalin-2-one (PubChem CID 66800391) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is (4aS)-3,3-dimethyl-1,4,4a,5,6,7-hexahydroquinoxalin-2-one.
| Compound Name | (4aS)-3,3-dimethyl-1,4,4a,5,6,7-hexahydroquinoxalin-2-one |
|---|---|
| PubChem CID | 66800391 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (4aS)-3,3-dimethyl-1,4,4a,5,6,7-hexahydroquinoxalin-2-one |
| SMILES | CC1(C)N[C@H]2CCCC=C2NC1=O |
| InChI | InChI=1S/C10H16N2O/c1-10(2)9(13)11-7-5-3-4-6-8(7)12-10/h5,8,12H,3-4,6H2,1-2H3,(H,11,13)/t8-/m0/s1 |
| InChIKey | ROUCLAUUYRCLLB-QMMMGPOBSA-N |
| XLogP | 0.92 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |