C28H52N2O6 — CID 66800465
2-[2-(2-propanoyloxyethoxy)propan-2-yloxy]ethyl 3-[4-[3-(1-ethylpiperidin-4-yl)propyl]piperidin-1-yl]propanoate (PubChem CID 66800465) has the molecular formula C28H52N2O6 and a molecular weight of 512.73 g/mol. Its IUPAC name is 2-[2-(2-propanoyloxyethoxy)propan-2-yloxy]ethyl 3-[4-[3-(1-ethylpiperidin-4-yl)propyl]piperidin-1-yl]propanoate.
| Compound Name | 2-[2-(2-propanoyloxyethoxy)propan-2-yloxy]ethyl 3-[4-[3-(1-ethylpiperidin-4-yl)propyl]piperidin-1-yl]propanoate |
|---|---|
| PubChem CID | 66800465 |
| Molecular Formula | C28H52N2O6 |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 512.38 |
| IUPAC Name | 2-[2-(2-propanoyloxyethoxy)propan-2-yloxy]ethyl 3-[4-[3-(1-ethylpiperidin-4-yl)propyl]piperidin-1-yl]propanoate |
| SMILES | CCC(=O)OCCOC(C)(C)OCCOC(=O)CCN1CCC(CCCC2CCN(CC)CC2)CC1 |
| InChI | InChI=1S/C28H52N2O6/c1-5-26(31)33-20-22-35-28(3,4)36-23-21-34-27(32)14-19-30-17-12-25(13-18-30)9-7-8-24-10-15-29(6-2)16-11-24/h24-25H,5-23H2,1-4H3 |
| InChIKey | VHYNXUOCRKHIDN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|