C19H23BF2N2O5S — CID 66800917
2,4-difluoro-N-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-N-methylbenzenesulfonamide (PubChem CID 66800917) has the molecular formula C19H23BF2N2O5S and a molecular weight of 440.28 g/mol. Its IUPAC name is 2,4-difluoro-N-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-N-methylbenzenesulfonamide.
| Compound Name | 2,4-difluoro-N-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 66800917 |
| Molecular Formula | C19H23BF2N2O5S |
| Molecular Weight | 440.28 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 2,4-difluoro-N-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-N-methylbenzenesulfonamide |
| SMILES | COc1ncc(B2OC(C)(C)C(C)(C)O2)cc1N(C)S(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H23BF2N2O5S/c1-18(2)19(3,4)29-20(28-18)12-9-15(17(27-6)23-11-12)24(5)30(25,26)16-8-7-13(21)10-14(16)22/h7-11H,1-6H3 |
| InChIKey | CPBNSOSWNCLVCX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|