C22H24FN5O3S — CID 66801132
N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-1H-pyrrolo[2,3-b]pyridine-2-sulfonamide (PubChem CID 66801132) has the molecular formula C22H24FN5O3S and a molecular weight of 457.53 g/mol. Its IUPAC name is N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-1H-pyrrolo[2,3-b]pyridine-2-sulfonamide.
| Compound Name | N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-1H-pyrrolo[2,3-b]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 66801132 |
| Molecular Formula | C22H24FN5O3S |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-1H-pyrrolo[2,3-b]pyridine-2-sulfonamide |
| SMILES | O=S(=O)(NCCCN1CCC(c2noc3cc(F)ccc23)CC1)c1cc2cccnc2[nH]1 |
| InChI | InChI=1S/C22H24FN5O3S/c23-17-4-5-18-19(14-17)31-27-21(18)15-6-11-28(12-7-15)10-2-9-25-32(29,30)20-13-16-3-1-8-24-22(16)26-20/h1,3-5,8,13-15,25H,2,6-7,9-12H2,(H,24,26) |
| InChIKey | JFOLKVANRZOEEJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|