C23H26FN5O3S — CID 66801246
N-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]imidazo[1,2-a]pyridine-3-sulfonamide (PubChem CID 66801246) has the molecular formula C23H26FN5O3S and a molecular weight of 471.56 g/mol. Its IUPAC name is N-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]imidazo[1,2-a]pyridine-3-sulfonamide.
| Compound Name | N-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]imidazo[1,2-a]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 66801246 |
| Molecular Formula | C23H26FN5O3S |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | N-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]imidazo[1,2-a]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCCCCN1CCC(c2noc3cc(F)ccc23)CC1)c1cnc2ccccn12 |
| InChI | InChI=1S/C23H26FN5O3S/c24-18-6-7-19-20(15-18)32-27-23(19)17-8-13-28(14-9-17)11-4-2-10-26-33(30,31)22-16-25-21-5-1-3-12-29(21)22/h1,3,5-7,12,15-17,26H,2,4,8-11,13-14H2 |
| InChIKey | PDHFVQWVURJQTK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 92.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|