About methyl N-[2-(2-chloro-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]carbamate
methyl N-[2-(2-chloro-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]carbamate (PubChem CID 66801447) has the molecular formula C14H9ClFN3O2S
and a molecular weight of 337.76 g/mol. Its IUPAC name is methyl N-[2-(2-chloro-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]carbamate.
Molecular Properties
| Compound Name | methyl N-[2-(2-chloro-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]carbamate |
| PubChem CID | 66801447 |
| Molecular Formula | C14H9ClFN3O2S |
| Molecular Weight | 337.76 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | methyl N-[2-(2-chloro-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]carbamate |
| SMILES | COC(=O)Nc1nccc2nc(-c3c(F)cccc3Cl)sc12 |
| InChI | InChI=1S/C14H9ClFN3O2S/c1-21-14(20)19-12-11-9(5-6-17-12)18-13(22-11)10-7(15)3-2-4-8(10)16/h2-6H,1H3,(H,17,19,20) |
| InChIKey | ZDCWQQPYVIEBOE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.76 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl N-[2-(2-chloro-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[2-(2-chloro-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]carbamate?
The IUPAC name of methyl N-[2-(2-chloro-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]carbamate (CID 66801447) is methyl N-[2-(2-chloro-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]carbamate.
What is the SMILES notation for methyl N-[2-(2-chloro-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]carbamate?
The canonical SMILES for methyl N-[2-(2-chloro-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]carbamate is COC(=O)Nc1nccc2nc(-c3c(F)cccc3Cl)sc12.
What is the InChIKey of methyl N-[2-(2-chloro-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]carbamate?
The InChIKey is ZDCWQQPYVIEBOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9ClFN3O2S/c1-21-14(20)19-12-11-9(5-6-17-12)18-13(22-11)10-7(15)3-2-4-8(10)16/h2-6H,1H3,(H,17,19,20).
What are the key properties of methyl N-[2-(2-chloro-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]carbamate?
methyl N-[2-(2-chloro-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]carbamate has a molecular weight of 337.76 g/mol, XLogP of 4.33, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[2-(2-chloro-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]carbamate is sourced from PubChem (CID 66801447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).