C30H29N3O2 — CID 66802322
3-[4-[1-(1H-indazol-5-yl)-2-(3-pyrrolidin-1-ylphenyl)but-1-enyl]phenyl]prop-2-enoic acid (PubChem CID 66802322) has the molecular formula C30H29N3O2 and a molecular weight of 463.58 g/mol. Its IUPAC name is 3-[4-[1-(1H-indazol-5-yl)-2-(3-pyrrolidin-1-ylphenyl)but-1-enyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[1-(1H-indazol-5-yl)-2-(3-pyrrolidin-1-ylphenyl)but-1-enyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66802322 |
| Molecular Formula | C30H29N3O2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | 3-[4-[1-(1H-indazol-5-yl)-2-(3-pyrrolidin-1-ylphenyl)but-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | CCC(=C(c1ccc(C=CC(=O)O)cc1)c1ccc2[nH]ncc2c1)c1cccc(N2CCCC2)c1 |
| InChI | InChI=1S/C30H29N3O2/c1-2-27(23-6-5-7-26(19-23)33-16-3-4-17-33)30(24-13-14-28-25(18-24)20-31-32-28)22-11-8-21(9-12-22)10-15-29(34)35/h5-15,18-20H,2-4,16-17H2,1H3,(H,31,32)(H,34,35) |
| InChIKey | PKMKFUNDJYKXMF-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|