About (3S)-3-(2,5-difluoro-4-methylsulfonylphenoxy)-1-piperidin-4-ylpiperidin-2-one
(3S)-3-(2,5-difluoro-4-methylsulfonylphenoxy)-1-piperidin-4-ylpiperidin-2-one (PubChem CID 66802663) has the molecular formula C17H22F2N2O4S
and a molecular weight of 388.44 g/mol. Its IUPAC name is (3S)-3-(2,5-difluoro-4-methylsulfonylphenoxy)-1-piperidin-4-ylpiperidin-2-one.
Molecular Properties
| Compound Name | (3S)-3-(2,5-difluoro-4-methylsulfonylphenoxy)-1-piperidin-4-ylpiperidin-2-one |
| PubChem CID | 66802663 |
| Molecular Formula | C17H22F2N2O4S |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | (3S)-3-(2,5-difluoro-4-methylsulfonylphenoxy)-1-piperidin-4-ylpiperidin-2-one |
| SMILES | CS(=O)(=O)c1cc(F)c(O[C@H]2CCCN(C3CCNCC3)C2=O)cc1F |
| InChI | InChI=1S/C17H22F2N2O4S/c1-26(23,24)16-10-12(18)15(9-13(16)19)25-14-3-2-8-21(17(14)22)11-4-6-20-7-5-11/h9-11,14,20H,2-8H2,1H3/t14-/m0/s1 |
| InChIKey | RGMWWERHJZUGTE-AWEZNQCLSA-N |
| XLogP | 1.49 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S)-3-(2,5-difluoro-4-methylsulfonylphenoxy)-1-piperidin-4-ylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-(2,5-difluoro-4-methylsulfonylphenoxy)-1-piperidin-4-ylpiperidin-2-one?
The IUPAC name of (3S)-3-(2,5-difluoro-4-methylsulfonylphenoxy)-1-piperidin-4-ylpiperidin-2-one (CID 66802663) is (3S)-3-(2,5-difluoro-4-methylsulfonylphenoxy)-1-piperidin-4-ylpiperidin-2-one.
What is the SMILES notation for (3S)-3-(2,5-difluoro-4-methylsulfonylphenoxy)-1-piperidin-4-ylpiperidin-2-one?
The canonical SMILES for (3S)-3-(2,5-difluoro-4-methylsulfonylphenoxy)-1-piperidin-4-ylpiperidin-2-one is CS(=O)(=O)c1cc(F)c(O[C@H]2CCCN(C3CCNCC3)C2=O)cc1F.
What is the InChIKey of (3S)-3-(2,5-difluoro-4-methylsulfonylphenoxy)-1-piperidin-4-ylpiperidin-2-one?
The InChIKey is RGMWWERHJZUGTE-AWEZNQCLSA-N. The full InChI is InChI=1S/C17H22F2N2O4S/c1-26(23,24)16-10-12(18)15(9-13(16)19)25-14-3-2-8-21(17(14)22)11-4-6-20-7-5-11/h9-11,14,20H,2-8H2,1H3/t14-/m0/s1.
What are the key properties of (3S)-3-(2,5-difluoro-4-methylsulfonylphenoxy)-1-piperidin-4-ylpiperidin-2-one?
(3S)-3-(2,5-difluoro-4-methylsulfonylphenoxy)-1-piperidin-4-ylpiperidin-2-one has a molecular weight of 388.44 g/mol, XLogP of 1.49, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(2,5-difluoro-4-methylsulfonylphenoxy)-1-piperidin-4-ylpiperidin-2-one is sourced from PubChem (CID 66802663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).