C25H21N3O2 — CID 66802737
(E)-3-[4-[(E)-2-phenyl-1-([1,2,4]triazolo[4,3-a]pyridin-6-yl)but-1-enyl]phenyl]prop-2-enoic acid (PubChem CID 66802737) has the molecular formula C25H21N3O2 and a molecular weight of 395.46 g/mol. Its IUPAC name is (E)-3-[4-[(E)-2-phenyl-1-([1,2,4]triazolo[4,3-a]pyridin-6-yl)but-1-enyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-2-phenyl-1-([1,2,4]triazolo[4,3-a]pyridin-6-yl)but-1-enyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66802737 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | (E)-3-[4-[(E)-2-phenyl-1-([1,2,4]triazolo[4,3-a]pyridin-6-yl)but-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | CC/C(=C(/c1ccc(/C=C/C(=O)O)cc1)c1ccc2nncn2c1)c1ccccc1 |
| InChI | InChI=1S/C25H21N3O2/c1-2-22(19-6-4-3-5-7-19)25(21-13-14-23-27-26-17-28(23)16-21)20-11-8-18(9-12-20)10-15-24(29)30/h3-17H,2H2,1H3,(H,29,30)/b15-10+,25-22+ |
| InChIKey | ISWSHCXREPELSB-IGTIAZLPSA-N |
| XLogP | 5.20 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|