C30H25F4N3O — CID 66802992
3-[4-[2-cyclobutyl-1-(3-fluoro-2H-indazol-5-yl)-2-phenylethenyl]phenyl]-N-(2,2,2-trifluoroethyl)prop-2-enamide (PubChem CID 66802992) has the molecular formula C30H25F4N3O and a molecular weight of 519.54 g/mol. Its IUPAC name is 3-[4-[2-cyclobutyl-1-(3-fluoro-2H-indazol-5-yl)-2-phenylethenyl]phenyl]-N-(2,2,2-trifluoroethyl)prop-2-enamide.
| Compound Name | 3-[4-[2-cyclobutyl-1-(3-fluoro-2H-indazol-5-yl)-2-phenylethenyl]phenyl]-N-(2,2,2-trifluoroethyl)prop-2-enamide |
|---|---|
| PubChem CID | 66802992 |
| Molecular Formula | C30H25F4N3O |
| Molecular Weight | 519.54 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | 3-[4-[2-cyclobutyl-1-(3-fluoro-2H-indazol-5-yl)-2-phenylethenyl]phenyl]-N-(2,2,2-trifluoroethyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(C(=C(c2ccccc2)C2CCC2)c2ccc3n[nH]c(F)c3c2)cc1)NCC(F)(F)F |
| InChI | InChI=1S/C30H25F4N3O/c31-29-24-17-23(14-15-25(24)36-37-29)28(27(21-7-4-8-21)20-5-2-1-3-6-20)22-12-9-19(10-13-22)11-16-26(38)35-18-30(32,33)34/h1-3,5-6,9-17,21H,4,7-8,18H2,(H,35,38)(H,36,37) |
| InChIKey | HJJKKBJKUMYDMH-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.54 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|