C19H14F4N8O2 — CID 66803150
2-N-(3-fluorophenyl)-2-N-methyl-6-[5-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-1,2,4-oxadiazol-3-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 66803150) has the molecular formula C19H14F4N8O2 and a molecular weight of 462.37 g/mol. Its IUPAC name is 2-N-(3-fluorophenyl)-2-N-methyl-6-[5-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-1,2,4-oxadiazol-3-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(3-fluorophenyl)-2-N-methyl-6-[5-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-1,2,4-oxadiazol-3-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 66803150 |
| Molecular Formula | C19H14F4N8O2 |
| Molecular Weight | 462.37 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 2-N-(3-fluorophenyl)-2-N-methyl-6-[5-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-1,2,4-oxadiazol-3-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | CN(c1cccc(F)c1)c1nc(N)nc(-c2noc(-c3ccc(OCC(F)(F)F)nc3)n2)n1 |
| InChI | InChI=1S/C19H14F4N8O2/c1-31(12-4-2-3-11(20)7-12)18-28-14(27-17(24)29-18)15-26-16(33-30-15)10-5-6-13(25-8-10)32-9-19(21,22)23/h2-8H,9H2,1H3,(H2,24,27,28,29) |
| InChIKey | LKVFKZUVQJKILL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |