C13H20F3NO2 — CID 66803251
tert-butyl 4-(3,3,3-trifluoropropylidene)piperidine-1-carboxylate (PubChem CID 66803251) has the molecular formula C13H20F3NO2 and a molecular weight of 279.30 g/mol. Its IUPAC name is tert-butyl 4-(3,3,3-trifluoropropylidene)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3,3,3-trifluoropropylidene)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66803251 |
| Molecular Formula | C13H20F3NO2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | tert-butyl 4-(3,3,3-trifluoropropylidene)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(=CCC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H20F3NO2/c1-12(2,3)19-11(18)17-8-5-10(6-9-17)4-7-13(14,15)16/h4H,5-9H2,1-3H3 |
| InChIKey | ILQZSAWLRHZZFJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|