C15H21N2+ — CID 66803283
1,1,2,4-tetrakis(prop-2-enyl)imidazol-1-ium (PubChem CID 66803283) has the molecular formula C15H21N2+ and a molecular weight of 229.35 g/mol. Its IUPAC name is 1,1,2,4-tetrakis(prop-2-enyl)imidazol-1-ium.
| Compound Name | 1,1,2,4-tetrakis(prop-2-enyl)imidazol-1-ium |
|---|---|
| PubChem CID | 66803283 |
| Molecular Formula | C15H21N2+ |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | 1,1,2,4-tetrakis(prop-2-enyl)imidazol-1-ium |
| SMILES | C=CCC1=C[N+](CC=C)(CC=C)C(CC=C)=N1 |
| InChI | InChI=1S/C15H21N2/c1-5-9-14-13-17(11-7-3,12-8-4)15(16-14)10-6-2/h5-8,13H,1-4,9-12H2/q+1 |
| InChIKey | VFUUHVMYUIEZSR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|