C8H12N2O — CID 66803355
3,4,4a,5,6,7-hexahydro-1H-quinoxalin-2-one (PubChem CID 66803355) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is 3,4,4a,5,6,7-hexahydro-1H-quinoxalin-2-one.
| Compound Name | 3,4,4a,5,6,7-hexahydro-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 66803355 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 3,4,4a,5,6,7-hexahydro-1H-quinoxalin-2-one |
| SMILES | O=C1CNC2CCCC=C2N1 |
| InChI | InChI=1S/C8H12N2O/c11-8-5-9-6-3-1-2-4-7(6)10-8/h4,6,9H,1-3,5H2,(H,10,11) |
| InChIKey | IYLHNXYIRKJIQZ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |