C22H24N4O4 — CID 66803535
(E)-3-[3-[5-[1-cyclohexyl-5-(methoxymethyl)pyrazol-4-yl]-1,2,4-oxadiazol-3-yl]phenyl]prop-2-enoic acid (PubChem CID 66803535) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is (E)-3-[3-[5-[1-cyclohexyl-5-(methoxymethyl)pyrazol-4-yl]-1,2,4-oxadiazol-3-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[5-[1-cyclohexyl-5-(methoxymethyl)pyrazol-4-yl]-1,2,4-oxadiazol-3-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66803535 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | (E)-3-[3-[5-[1-cyclohexyl-5-(methoxymethyl)pyrazol-4-yl]-1,2,4-oxadiazol-3-yl]phenyl]prop-2-enoic acid |
| SMILES | COCc1c(-c2nc(-c3cccc(/C=C/C(=O)O)c3)no2)cnn1C1CCCCC1 |
| InChI | InChI=1S/C22H24N4O4/c1-29-14-19-18(13-23-26(19)17-8-3-2-4-9-17)22-24-21(25-30-22)16-7-5-6-15(12-16)10-11-20(27)28/h5-7,10-13,17H,2-4,8-9,14H2,1H3,(H,27,28)/b11-10+ |
| InChIKey | KHHMAADATMDATK-ZHACJKMWSA-N |
| XLogP | 4.35 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|