About 1,6-di(propan-2-yl)imidazo[2,1-e]pyrazole
1,6-di(propan-2-yl)imidazo[2,1-e]pyrazole (PubChem CID 66803868) has the molecular formula C11H17N3
and a molecular weight of 191.28 g/mol. Its IUPAC name is 1,6-di(propan-2-yl)imidazo[2,1-e]pyrazole.
Molecular Properties
| Compound Name | 1,6-di(propan-2-yl)imidazo[2,1-e]pyrazole |
| PubChem CID | 66803868 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 1,6-di(propan-2-yl)imidazo[2,1-e]pyrazole |
| SMILES | CC(C)c1cc2n(C(C)C)ccn2n1 |
| InChI | InChI=1S/C11H17N3/c1-8(2)10-7-11-13(9(3)4)5-6-14(11)12-10/h5-9H,1-4H3 |
| InChIKey | GCTREKIINYLVSJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 22.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,6-di(propan-2-yl)imidazo[2,1-e]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-di(propan-2-yl)imidazo[2,1-e]pyrazole?
The IUPAC name of 1,6-di(propan-2-yl)imidazo[2,1-e]pyrazole (CID 66803868) is 1,6-di(propan-2-yl)imidazo[2,1-e]pyrazole.
What is the SMILES notation for 1,6-di(propan-2-yl)imidazo[2,1-e]pyrazole?
The canonical SMILES for 1,6-di(propan-2-yl)imidazo[2,1-e]pyrazole is CC(C)c1cc2n(C(C)C)ccn2n1.
What is the InChIKey of 1,6-di(propan-2-yl)imidazo[2,1-e]pyrazole?
The InChIKey is GCTREKIINYLVSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3/c1-8(2)10-7-11-13(9(3)4)5-6-14(11)12-10/h5-9H,1-4H3.
What are the key properties of 1,6-di(propan-2-yl)imidazo[2,1-e]pyrazole?
1,6-di(propan-2-yl)imidazo[2,1-e]pyrazole has a molecular weight of 191.28 g/mol, XLogP of 2.84, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-di(propan-2-yl)imidazo[2,1-e]pyrazole is sourced from PubChem (CID 66803868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).