About N,N-dimethyl-7-methylidene-3,6-dihydroinden-5-amine
N,N-dimethyl-7-methylidene-3,6-dihydroinden-5-amine (PubChem CID 66804653) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is N,N-dimethyl-7-methylidene-3,6-dihydroinden-5-amine.
Molecular Properties
| Compound Name | N,N-dimethyl-7-methylidene-3,6-dihydroinden-5-amine |
| PubChem CID | 66804653 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | N,N-dimethyl-7-methylidene-3,6-dihydroinden-5-amine |
| SMILES | C=C1CC(N(C)C)=CC2=C1C=CC2 |
| InChI | InChI=1S/C12H15N/c1-9-7-11(13(2)3)8-10-5-4-6-12(9)10/h4,6,8H,1,5,7H2,2-3H3 |
| InChIKey | UEBXIHDDTSCYEW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethyl-7-methylidene-3,6-dihydroinden-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-7-methylidene-3,6-dihydroinden-5-amine?
The IUPAC name of N,N-dimethyl-7-methylidene-3,6-dihydroinden-5-amine (CID 66804653) is N,N-dimethyl-7-methylidene-3,6-dihydroinden-5-amine.
What is the SMILES notation for N,N-dimethyl-7-methylidene-3,6-dihydroinden-5-amine?
The canonical SMILES for N,N-dimethyl-7-methylidene-3,6-dihydroinden-5-amine is C=C1CC(N(C)C)=CC2=C1C=CC2.
What is the InChIKey of N,N-dimethyl-7-methylidene-3,6-dihydroinden-5-amine?
The InChIKey is UEBXIHDDTSCYEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N/c1-9-7-11(13(2)3)8-10-5-4-6-12(9)10/h4,6,8H,1,5,7H2,2-3H3.
What are the key properties of N,N-dimethyl-7-methylidene-3,6-dihydroinden-5-amine?
N,N-dimethyl-7-methylidene-3,6-dihydroinden-5-amine has a molecular weight of 173.26 g/mol, XLogP of 2.65, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-7-methylidene-3,6-dihydroinden-5-amine is sourced from PubChem (CID 66804653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).