C62H49N5O2 — CID 66804907
tert-butyl 2-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,7-dimethylindeno[2,1-b]carbazol-2-yl]-7,7-dimethylindeno[2,1-b]carbazole-5-carboxylate (PubChem CID 66804907) has the molecular formula C62H49N5O2 and a molecular weight of 896.11 g/mol. Its IUPAC name is tert-butyl 2-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,7-dimethylindeno[2,1-b]carbazol-2-yl]-7,7-dimethylindeno[2,1-b]carbazole-5-carboxylate.
| Compound Name | tert-butyl 2-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,7-dimethylindeno[2,1-b]carbazol-2-yl]-7,7-dimethylindeno[2,1-b]carbazole-5-carboxylate |
|---|---|
| PubChem CID | 66804907 |
| Molecular Formula | C62H49N5O2 |
| Molecular Weight | 896.11 g/mol |
| Exact Mass | 895.39 |
| IUPAC Name | tert-butyl 2-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,7-dimethylindeno[2,1-b]carbazol-2-yl]-7,7-dimethylindeno[2,1-b]carbazole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c2ccc(-c3ccc4c(c3)c3cc5c(cc3n4-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)C(C)(C)c3ccccc3-5)cc2c2cc3c(cc21)C(C)(C)c1ccccc1-3 |
| InChI | InChI=1S/C62H49N5O2/c1-60(2,3)69-59(68)67-53-29-27-39(31-45(53)47-33-43-41-23-15-17-25-49(41)62(6,7)51(43)35-55(47)67)38-26-28-52-44(30-38)46-32-42-40-22-14-16-24-48(40)61(4,5)50(42)34-54(46)66(52)58-64-56(36-18-10-8-11-19-36)63-57(65-58)37-20-12-9-13-21-37/h8-35H,1-7H3 |
| InChIKey | RADRSGGTATYPGT-UHFFFAOYSA-N |
| XLogP | 15.47 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.11 |
| LogP ≤ 5 | 15.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |