About 3-cyclobutylimino-5-(3,4-difluorophenyl)-N-pyridin-3-ylphenazin-2-amine
3-cyclobutylimino-5-(3,4-difluorophenyl)-N-pyridin-3-ylphenazin-2-amine (PubChem CID 66805623) has the molecular formula C27H21F2N5
and a molecular weight of 453.50 g/mol. Its IUPAC name is 3-cyclobutylimino-5-(3,4-difluorophenyl)-N-pyridin-3-ylphenazin-2-amine.
Molecular Properties
| Compound Name | 3-cyclobutylimino-5-(3,4-difluorophenyl)-N-pyridin-3-ylphenazin-2-amine |
| PubChem CID | 66805623 |
| Molecular Formula | C27H21F2N5 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 3-cyclobutylimino-5-(3,4-difluorophenyl)-N-pyridin-3-ylphenazin-2-amine |
| SMILES | Fc1ccc(-n2c3c/c(=N\C4CCC4)c(Nc4cccnc4)cc-3nc3ccccc32)cc1F |
| InChI | InChI=1S/C27H21F2N5/c28-20-11-10-19(13-21(20)29)34-26-9-2-1-8-22(26)33-25-14-23(32-18-7-4-12-30-16-18)24(15-27(25)34)31-17-5-3-6-17/h1-2,4,7-17,32H,3,5-6H2/b31-24+ |
| InChIKey | BQGTVOUHCQXNHO-QFMPWRQOSA-N |
| XLogP | 6.00 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclobutylimino-5-(3,4-difluorophenyl)-N-pyridin-3-ylphenazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclobutylimino-5-(3,4-difluorophenyl)-N-pyridin-3-ylphenazin-2-amine?
The IUPAC name of 3-cyclobutylimino-5-(3,4-difluorophenyl)-N-pyridin-3-ylphenazin-2-amine (CID 66805623) is 3-cyclobutylimino-5-(3,4-difluorophenyl)-N-pyridin-3-ylphenazin-2-amine.
What is the SMILES notation for 3-cyclobutylimino-5-(3,4-difluorophenyl)-N-pyridin-3-ylphenazin-2-amine?
The canonical SMILES for 3-cyclobutylimino-5-(3,4-difluorophenyl)-N-pyridin-3-ylphenazin-2-amine is Fc1ccc(-n2c3c/c(=N\C4CCC4)c(Nc4cccnc4)cc-3nc3ccccc32)cc1F.
What is the InChIKey of 3-cyclobutylimino-5-(3,4-difluorophenyl)-N-pyridin-3-ylphenazin-2-amine?
The InChIKey is BQGTVOUHCQXNHO-QFMPWRQOSA-N. The full InChI is InChI=1S/C27H21F2N5/c28-20-11-10-19(13-21(20)29)34-26-9-2-1-8-22(26)33-25-14-23(32-18-7-4-12-30-16-18)24(15-27(25)34)31-17-5-3-6-17/h1-2,4,7-17,32H,3,5-6H2/b31-24+.
What are the key properties of 3-cyclobutylimino-5-(3,4-difluorophenyl)-N-pyridin-3-ylphenazin-2-amine?
3-cyclobutylimino-5-(3,4-difluorophenyl)-N-pyridin-3-ylphenazin-2-amine has a molecular weight of 453.50 g/mol, XLogP of 6.00, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclobutylimino-5-(3,4-difluorophenyl)-N-pyridin-3-ylphenazin-2-amine is sourced from PubChem (CID 66805623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).