About (3R,4R)-2-benzyl-4-methyl-3-(3-methylbutan-2-yl)-1,2-oxazolidin-5-one
(3R,4R)-2-benzyl-4-methyl-3-(3-methylbutan-2-yl)-1,2-oxazolidin-5-one (PubChem CID 66805707) has the molecular formula C16H23NO2
and a molecular weight of 261.36 g/mol. Its IUPAC name is (3R,4R)-2-benzyl-4-methyl-3-(3-methylbutan-2-yl)-1,2-oxazolidin-5-one.
Molecular Properties
| Compound Name | (3R,4R)-2-benzyl-4-methyl-3-(3-methylbutan-2-yl)-1,2-oxazolidin-5-one |
| PubChem CID | 66805707 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (3R,4R)-2-benzyl-4-methyl-3-(3-methylbutan-2-yl)-1,2-oxazolidin-5-one |
| SMILES | CC(C)C(C)[C@@H]1[C@@H](C)C(=O)ON1Cc1ccccc1 |
| InChI | InChI=1S/C16H23NO2/c1-11(2)12(3)15-13(4)16(18)19-17(15)10-14-8-6-5-7-9-14/h5-9,11-13,15H,10H2,1-4H3/t12?,13-,15-/m1/s1 |
| InChIKey | KKTRTAYCFJVMSR-JYRZLJSNSA-N |
| XLogP | 3.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,4R)-2-benzyl-4-methyl-3-(3-methylbutan-2-yl)-1,2-oxazolidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-2-benzyl-4-methyl-3-(3-methylbutan-2-yl)-1,2-oxazolidin-5-one?
The IUPAC name of (3R,4R)-2-benzyl-4-methyl-3-(3-methylbutan-2-yl)-1,2-oxazolidin-5-one (CID 66805707) is (3R,4R)-2-benzyl-4-methyl-3-(3-methylbutan-2-yl)-1,2-oxazolidin-5-one.
What is the SMILES notation for (3R,4R)-2-benzyl-4-methyl-3-(3-methylbutan-2-yl)-1,2-oxazolidin-5-one?
The canonical SMILES for (3R,4R)-2-benzyl-4-methyl-3-(3-methylbutan-2-yl)-1,2-oxazolidin-5-one is CC(C)C(C)[C@@H]1[C@@H](C)C(=O)ON1Cc1ccccc1.
What is the InChIKey of (3R,4R)-2-benzyl-4-methyl-3-(3-methylbutan-2-yl)-1,2-oxazolidin-5-one?
The InChIKey is KKTRTAYCFJVMSR-JYRZLJSNSA-N. The full InChI is InChI=1S/C16H23NO2/c1-11(2)12(3)15-13(4)16(18)19-17(15)10-14-8-6-5-7-9-14/h5-9,11-13,15H,10H2,1-4H3/t12?,13-,15-/m1/s1.
What are the key properties of (3R,4R)-2-benzyl-4-methyl-3-(3-methylbutan-2-yl)-1,2-oxazolidin-5-one?
(3R,4R)-2-benzyl-4-methyl-3-(3-methylbutan-2-yl)-1,2-oxazolidin-5-one has a molecular weight of 261.36 g/mol, XLogP of 3.26, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-2-benzyl-4-methyl-3-(3-methylbutan-2-yl)-1,2-oxazolidin-5-one is sourced from PubChem (CID 66805707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).