C12H6Br2O2S2 — CID 66806016
2,7-dibromo-3,6-dimethylthieno[3,2-g][1]benzothiole-4,5-dione (PubChem CID 66806016) has the molecular formula C12H6Br2O2S2 and a molecular weight of 406.12 g/mol. Its IUPAC name is 2,7-dibromo-3,6-dimethylthieno[3,2-g][1]benzothiole-4,5-dione.
| Compound Name | 2,7-dibromo-3,6-dimethylthieno[3,2-g][1]benzothiole-4,5-dione |
|---|---|
| PubChem CID | 66806016 |
| Molecular Formula | C12H6Br2O2S2 |
| Molecular Weight | 406.12 g/mol |
| Exact Mass | 403.82 |
| IUPAC Name | 2,7-dibromo-3,6-dimethylthieno[3,2-g][1]benzothiole-4,5-dione |
| SMILES | Cc1c(Br)sc2c1C(=O)C(=O)c1c-2sc(Br)c1C |
| InChI | InChI=1S/C12H6Br2O2S2/c1-3-5-7(15)8(16)6-4(2)12(14)18-10(6)9(5)17-11(3)13/h1-2H3 |
| InChIKey | FWEDTTRMNRJSPS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.12 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|