C18H18ClN3O2S — CID 66806145
N-(3-chlorophenyl)-5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-8-sulfonamide (PubChem CID 66806145) has the molecular formula C18H18ClN3O2S and a molecular weight of 375.88 g/mol. Its IUPAC name is N-(3-chlorophenyl)-5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-8-sulfonamide.
| Compound Name | N-(3-chlorophenyl)-5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-8-sulfonamide |
|---|---|
| PubChem CID | 66806145 |
| Molecular Formula | C18H18ClN3O2S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | N-(3-chlorophenyl)-5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-8-sulfonamide |
| SMILES | Cn1c2c(c3cc(S(=O)(=O)Nc4cccc(Cl)c4)ccc31)CNCC2 |
| InChI | InChI=1S/C18H18ClN3O2S/c1-22-17-6-5-14(10-15(17)16-11-20-8-7-18(16)22)25(23,24)21-13-4-2-3-12(19)9-13/h2-6,9-10,20-21H,7-8,11H2,1H3 |
| InChIKey | VFPWEEZAQVCXQV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|