About methyl 4-aminocyclohexa-1,5-diene-1-carboxylate
methyl 4-aminocyclohexa-1,5-diene-1-carboxylate (PubChem CID 66806205) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is methyl 4-aminocyclohexa-1,5-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4-aminocyclohexa-1,5-diene-1-carboxylate |
| PubChem CID | 66806205 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | methyl 4-aminocyclohexa-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=CCC(N)C=C1 |
| InChI | InChI=1S/C8H11NO2/c1-11-8(10)6-2-4-7(9)5-3-6/h2-4,7H,5,9H2,1H3 |
| InChIKey | LUYPERSPRRTJMM-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4-aminocyclohexa-1,5-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-aminocyclohexa-1,5-diene-1-carboxylate?
The IUPAC name of methyl 4-aminocyclohexa-1,5-diene-1-carboxylate (CID 66806205) is methyl 4-aminocyclohexa-1,5-diene-1-carboxylate.
What is the SMILES notation for methyl 4-aminocyclohexa-1,5-diene-1-carboxylate?
The canonical SMILES for methyl 4-aminocyclohexa-1,5-diene-1-carboxylate is COC(=O)C1=CCC(N)C=C1.
What is the InChIKey of methyl 4-aminocyclohexa-1,5-diene-1-carboxylate?
The InChIKey is LUYPERSPRRTJMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-11-8(10)6-2-4-7(9)5-3-6/h2-4,7H,5,9H2,1H3.
What are the key properties of methyl 4-aminocyclohexa-1,5-diene-1-carboxylate?
methyl 4-aminocyclohexa-1,5-diene-1-carboxylate has a molecular weight of 153.18 g/mol, XLogP of 0.37, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-aminocyclohexa-1,5-diene-1-carboxylate is sourced from PubChem (CID 66806205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).