About 3-[(7-methoxy-3-methyl-1-benzothiophen-2-yl)sulfonylamino]cyclohexa-2,4-diene-1-carboxylic acid
3-[(7-methoxy-3-methyl-1-benzothiophen-2-yl)sulfonylamino]cyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 66806578) has the molecular formula C17H17NO5S2
and a molecular weight of 379.46 g/mol. Its IUPAC name is 3-[(7-methoxy-3-methyl-1-benzothiophen-2-yl)sulfonylamino]cyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-[(7-methoxy-3-methyl-1-benzothiophen-2-yl)sulfonylamino]cyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 66806578 |
| Molecular Formula | C17H17NO5S2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 3-[(7-methoxy-3-methyl-1-benzothiophen-2-yl)sulfonylamino]cyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | COc1cccc2c(C)c(S(=O)(=O)NC3=CC(C(=O)O)CC=C3)sc12 |
| InChI | InChI=1S/C17H17NO5S2/c1-10-13-7-4-8-14(23-2)15(13)24-17(10)25(21,22)18-12-6-3-5-11(9-12)16(19)20/h3-4,6-9,11,18H,5H2,1-2H3,(H,19,20) |
| InChIKey | OXTOWYJMWAOAAY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(7-methoxy-3-methyl-1-benzothiophen-2-yl)sulfonylamino]cyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(7-methoxy-3-methyl-1-benzothiophen-2-yl)sulfonylamino]cyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 3-[(7-methoxy-3-methyl-1-benzothiophen-2-yl)sulfonylamino]cyclohexa-2,4-diene-1-carboxylic acid (CID 66806578) is 3-[(7-methoxy-3-methyl-1-benzothiophen-2-yl)sulfonylamino]cyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 3-[(7-methoxy-3-methyl-1-benzothiophen-2-yl)sulfonylamino]cyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 3-[(7-methoxy-3-methyl-1-benzothiophen-2-yl)sulfonylamino]cyclohexa-2,4-diene-1-carboxylic acid is COc1cccc2c(C)c(S(=O)(=O)NC3=CC(C(=O)O)CC=C3)sc12.
What is the InChIKey of 3-[(7-methoxy-3-methyl-1-benzothiophen-2-yl)sulfonylamino]cyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is OXTOWYJMWAOAAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO5S2/c1-10-13-7-4-8-14(23-2)15(13)24-17(10)25(21,22)18-12-6-3-5-11(9-12)16(19)20/h3-4,6-9,11,18H,5H2,1-2H3,(H,19,20).
What are the key properties of 3-[(7-methoxy-3-methyl-1-benzothiophen-2-yl)sulfonylamino]cyclohexa-2,4-diene-1-carboxylic acid?
3-[(7-methoxy-3-methyl-1-benzothiophen-2-yl)sulfonylamino]cyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 379.46 g/mol, XLogP of 3.04, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(7-methoxy-3-methyl-1-benzothiophen-2-yl)sulfonylamino]cyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 66806578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).