About [3-[(1S)-1-(4,5-dihydro-1H-imidazol-5-yl)ethyl]-2-methylphenyl]methyl 3-phenylpropanoate
[3-[(1S)-1-(4,5-dihydro-1H-imidazol-5-yl)ethyl]-2-methylphenyl]methyl 3-phenylpropanoate (PubChem CID 66806629) has the molecular formula C22H26N2O2
and a molecular weight of 350.46 g/mol. Its IUPAC name is [3-[(1S)-1-(4,5-dihydro-1H-imidazol-5-yl)ethyl]-2-methylphenyl]methyl 3-phenylpropanoate.
Molecular Properties
| Compound Name | [3-[(1S)-1-(4,5-dihydro-1H-imidazol-5-yl)ethyl]-2-methylphenyl]methyl 3-phenylpropanoate |
| PubChem CID | 66806629 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | [3-[(1S)-1-(4,5-dihydro-1H-imidazol-5-yl)ethyl]-2-methylphenyl]methyl 3-phenylpropanoate |
| SMILES | Cc1c(COC(=O)CCc2ccccc2)cccc1[C@H](C)C1CN=CN1 |
| InChI | InChI=1S/C22H26N2O2/c1-16-19(9-6-10-20(16)17(2)21-13-23-15-24-21)14-26-22(25)12-11-18-7-4-3-5-8-18/h3-10,15,17,21H,11-14H2,1-2H3,(H,23,24)/t17-,21?/m0/s1 |
| InChIKey | YKROTVMMIPPITM-PBVYKCSPSA-N |
| XLogP | 3.77 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-[(1S)-1-(4,5-dihydro-1H-imidazol-5-yl)ethyl]-2-methylphenyl]methyl 3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(1S)-1-(4,5-dihydro-1H-imidazol-5-yl)ethyl]-2-methylphenyl]methyl 3-phenylpropanoate?
The IUPAC name of [3-[(1S)-1-(4,5-dihydro-1H-imidazol-5-yl)ethyl]-2-methylphenyl]methyl 3-phenylpropanoate (CID 66806629) is [3-[(1S)-1-(4,5-dihydro-1H-imidazol-5-yl)ethyl]-2-methylphenyl]methyl 3-phenylpropanoate.
What is the SMILES notation for [3-[(1S)-1-(4,5-dihydro-1H-imidazol-5-yl)ethyl]-2-methylphenyl]methyl 3-phenylpropanoate?
The canonical SMILES for [3-[(1S)-1-(4,5-dihydro-1H-imidazol-5-yl)ethyl]-2-methylphenyl]methyl 3-phenylpropanoate is Cc1c(COC(=O)CCc2ccccc2)cccc1[C@H](C)C1CN=CN1.
What is the InChIKey of [3-[(1S)-1-(4,5-dihydro-1H-imidazol-5-yl)ethyl]-2-methylphenyl]methyl 3-phenylpropanoate?
The InChIKey is YKROTVMMIPPITM-PBVYKCSPSA-N. The full InChI is InChI=1S/C22H26N2O2/c1-16-19(9-6-10-20(16)17(2)21-13-23-15-24-21)14-26-22(25)12-11-18-7-4-3-5-8-18/h3-10,15,17,21H,11-14H2,1-2H3,(H,23,24)/t17-,21?/m0/s1.
What are the key properties of [3-[(1S)-1-(4,5-dihydro-1H-imidazol-5-yl)ethyl]-2-methylphenyl]methyl 3-phenylpropanoate?
[3-[(1S)-1-(4,5-dihydro-1H-imidazol-5-yl)ethyl]-2-methylphenyl]methyl 3-phenylpropanoate has a molecular weight of 350.46 g/mol, XLogP of 3.77, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(1S)-1-(4,5-dihydro-1H-imidazol-5-yl)ethyl]-2-methylphenyl]methyl 3-phenylpropanoate is sourced from PubChem (CID 66806629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).