About N-ethenyl-4,6-dimethylcyclohex-3-en-1-amine
N-ethenyl-4,6-dimethylcyclohex-3-en-1-amine (PubChem CID 66806733) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is N-ethenyl-4,6-dimethylcyclohex-3-en-1-amine.
Molecular Properties
| Compound Name | N-ethenyl-4,6-dimethylcyclohex-3-en-1-amine |
| PubChem CID | 66806733 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | N-ethenyl-4,6-dimethylcyclohex-3-en-1-amine |
| SMILES | C=CNC1CC=C(C)CC1C |
| InChI | InChI=1S/C10H17N/c1-4-11-10-6-5-8(2)7-9(10)3/h4-5,9-11H,1,6-7H2,2-3H3 |
| InChIKey | XGNSRDZJQGWLST-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-4,6-dimethylcyclohex-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-4,6-dimethylcyclohex-3-en-1-amine?
The IUPAC name of N-ethenyl-4,6-dimethylcyclohex-3-en-1-amine (CID 66806733) is N-ethenyl-4,6-dimethylcyclohex-3-en-1-amine.
What is the SMILES notation for N-ethenyl-4,6-dimethylcyclohex-3-en-1-amine?
The canonical SMILES for N-ethenyl-4,6-dimethylcyclohex-3-en-1-amine is C=CNC1CC=C(C)CC1C.
What is the InChIKey of N-ethenyl-4,6-dimethylcyclohex-3-en-1-amine?
The InChIKey is XGNSRDZJQGWLST-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-4-11-10-6-5-8(2)7-9(10)3/h4-5,9-11H,1,6-7H2,2-3H3.
What are the key properties of N-ethenyl-4,6-dimethylcyclohex-3-en-1-amine?
N-ethenyl-4,6-dimethylcyclohex-3-en-1-amine has a molecular weight of 151.25 g/mol, XLogP of 2.46, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-4,6-dimethylcyclohex-3-en-1-amine is sourced from PubChem (CID 66806733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).