C26H37BrO3 — CID 66806745
(1R,10R,13R,15S,18S)-15-bromo-5-(methoxymethoxy)-10,14,14,18-tetramethyl-6-prop-2-enyl-9-oxatetracyclo[8.7.1.01,13.03,8]octadeca-3,5,7-triene (PubChem CID 66806745) has the molecular formula C26H37BrO3 and a molecular weight of 477.48 g/mol. Its IUPAC name is (1R,10R,13R,15S,18S)-15-bromo-5-(methoxymethoxy)-10,14,14,18-tetramethyl-6-prop-2-enyl-9-oxatetracyclo[8.7.1.01,13.03,8]octadeca-3,5,7-triene.
| Compound Name | (1R,10R,13R,15S,18S)-15-bromo-5-(methoxymethoxy)-10,14,14,18-tetramethyl-6-prop-2-enyl-9-oxatetracyclo[8.7.1.01,13.03,8]octadeca-3,5,7-triene |
|---|---|
| PubChem CID | 66806745 |
| Molecular Formula | C26H37BrO3 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | (1R,10R,13R,15S,18S)-15-bromo-5-(methoxymethoxy)-10,14,14,18-tetramethyl-6-prop-2-enyl-9-oxatetracyclo[8.7.1.01,13.03,8]octadeca-3,5,7-triene |
| SMILES | C=CCc1cc2c(cc1OCOC)C[C@]13CC[C@H](Br)C(C)(C)[C@@H]1CC[C@@](C)(O2)[C@H]3C |
| InChI | InChI=1S/C26H37BrO3/c1-7-8-18-13-21-19(14-20(18)29-16-28-6)15-26-12-10-23(27)24(3,4)22(26)9-11-25(5,30-21)17(26)2/h7,13-14,17,22-23H,1,8-12,15-16H2,2-6H3/t17-,22+,23+,25-,26+/m1/s1 |
| InChIKey | XRJGNYOVZJSWJZ-QTZYUAOESA-N |
| XLogP | 6.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|