C11H17BrO4 — CID 66806841
(3aS,5R,8S,9aR)-8-bromo-5,7,7-trimethyl-3a,4,5,8,9,9a-hexahydro-[1,3]dioxolo[4,5-d]oxocin-2-one (PubChem CID 66806841) has the molecular formula C11H17BrO4 and a molecular weight of 293.16 g/mol. Its IUPAC name is (3aS,5R,8S,9aR)-8-bromo-5,7,7-trimethyl-3a,4,5,8,9,9a-hexahydro-[1,3]dioxolo[4,5-d]oxocin-2-one.
| Compound Name | (3aS,5R,8S,9aR)-8-bromo-5,7,7-trimethyl-3a,4,5,8,9,9a-hexahydro-[1,3]dioxolo[4,5-d]oxocin-2-one |
|---|---|
| PubChem CID | 66806841 |
| Molecular Formula | C11H17BrO4 |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | (3aS,5R,8S,9aR)-8-bromo-5,7,7-trimethyl-3a,4,5,8,9,9a-hexahydro-[1,3]dioxolo[4,5-d]oxocin-2-one |
| SMILES | C[C@@H]1C[C@@H]2OC(=O)O[C@@H]2C[C@H](Br)C(C)(C)O1 |
| InChI | InChI=1S/C11H17BrO4/c1-6-4-7-8(15-10(13)14-7)5-9(12)11(2,3)16-6/h6-9H,4-5H2,1-3H3/t6-,7+,8-,9+/m1/s1 |
| InChIKey | BFNMUFVVMFLHBG-XAVMHZPKSA-N |
| XLogP | 2.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|