C26H16B2N2O8 — CID 66806890
[4-[13-(4-boronophenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]phenyl]boronic acid (PubChem CID 66806890) has the molecular formula C26H16B2N2O8 and a molecular weight of 506.04 g/mol. Its IUPAC name is [4-[13-(4-boronophenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]phenyl]boronic acid.
| Compound Name | [4-[13-(4-boronophenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 66806890 |
| Molecular Formula | C26H16B2N2O8 |
| Molecular Weight | 506.04 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | [4-[13-(4-boronophenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]phenyl]boronic acid |
| SMILES | O=C1c2ccc3c4c(ccc(c24)C(=O)N1c1ccc(B(O)O)cc1)C(=O)N(c1ccc(B(O)O)cc1)C3=O |
| InChI | InChI=1S/C26H16B2N2O8/c31-23-17-9-11-19-22-20(26(34)30(25(19)33)16-7-3-14(4-8-16)28(37)38)12-10-18(21(17)22)24(32)29(23)15-5-1-13(2-6-15)27(35)36/h1-12,35-38H |
| InChIKey | GXQOURXBURUDBW-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.04 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|