About 2,5-difluoro-4-methylsulfonylcyclohexa-1,5-dien-1-amine
2,5-difluoro-4-methylsulfonylcyclohexa-1,5-dien-1-amine (PubChem CID 66806896) has the molecular formula C7H9F2NO2S
and a molecular weight of 209.22 g/mol. Its IUPAC name is 2,5-difluoro-4-methylsulfonylcyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 2,5-difluoro-4-methylsulfonylcyclohexa-1,5-dien-1-amine |
| PubChem CID | 66806896 |
| Molecular Formula | C7H9F2NO2S |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 2,5-difluoro-4-methylsulfonylcyclohexa-1,5-dien-1-amine |
| SMILES | CS(=O)(=O)C1CC(F)=C(N)C=C1F |
| InChI | InChI=1S/C7H9F2NO2S/c1-13(11,12)7-3-4(8)6(10)2-5(7)9/h2,7H,3,10H2,1H3 |
| InChIKey | UUFGOQDYGCQPBK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-difluoro-4-methylsulfonylcyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-difluoro-4-methylsulfonylcyclohexa-1,5-dien-1-amine?
The IUPAC name of 2,5-difluoro-4-methylsulfonylcyclohexa-1,5-dien-1-amine (CID 66806896) is 2,5-difluoro-4-methylsulfonylcyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 2,5-difluoro-4-methylsulfonylcyclohexa-1,5-dien-1-amine?
The canonical SMILES for 2,5-difluoro-4-methylsulfonylcyclohexa-1,5-dien-1-amine is CS(=O)(=O)C1CC(F)=C(N)C=C1F.
What is the InChIKey of 2,5-difluoro-4-methylsulfonylcyclohexa-1,5-dien-1-amine?
The InChIKey is UUFGOQDYGCQPBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F2NO2S/c1-13(11,12)7-3-4(8)6(10)2-5(7)9/h2,7H,3,10H2,1H3.
What are the key properties of 2,5-difluoro-4-methylsulfonylcyclohexa-1,5-dien-1-amine?
2,5-difluoro-4-methylsulfonylcyclohexa-1,5-dien-1-amine has a molecular weight of 209.22 g/mol, XLogP of 0.80, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-difluoro-4-methylsulfonylcyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 66806896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).