C16H21BN4O4S — CID 66806993
2-amino-N-pyridin-3-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-sulfonamide (PubChem CID 66806993) has the molecular formula C16H21BN4O4S and a molecular weight of 376.25 g/mol. Its IUPAC name is 2-amino-N-pyridin-3-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-sulfonamide.
| Compound Name | 2-amino-N-pyridin-3-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 66806993 |
| Molecular Formula | C16H21BN4O4S |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-amino-N-pyridin-3-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-sulfonamide |
| SMILES | CC1(C)OB(c2cnc(N)c(S(=O)(=O)Nc3cccnc3)c2)OC1(C)C |
| InChI | InChI=1S/C16H21BN4O4S/c1-15(2)16(3,4)25-17(24-15)11-8-13(14(18)20-9-11)26(22,23)21-12-6-5-7-19-10-12/h5-10,21H,1-4H3,(H2,18,20) |
| InChIKey | FOTPLNNXGMIVNN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 116.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|