C25H20N4 — CID 66807100
9,9'-spirobi[fluorene]-2,2',7,7'-tetramine (PubChem CID 66807100) has the molecular formula C25H20N4 and a molecular weight of 376.46 g/mol. Its IUPAC name is 9,9'-spirobi[fluorene]-2,2',7,7'-tetramine.
| Compound Name | 9,9'-spirobi[fluorene]-2,2',7,7'-tetramine |
|---|---|
| PubChem CID | 66807100 |
| Molecular Formula | C25H20N4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 9,9'-spirobi[fluorene]-2,2',7,7'-tetramine |
| SMILES | Nc1ccc2c(c1)C1(c3cc(N)ccc3-2)c2cc(N)ccc2-c2ccc(N)cc21 |
| InChI | InChI=1S/C25H20N4/c26-13-1-5-17-18-6-2-14(27)10-22(18)25(21(17)9-13)23-11-15(28)3-7-19(23)20-8-4-16(29)12-24(20)25/h1-12H,26-29H2 |
| InChIKey | PTQXFKFYBWOKTN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|