C29H31N5O2S — CID 66807189
N-[(3R)-1-(1-benzothiophen-3-ylmethyl)piperidin-3-yl]-3-(2,3-dihydro-1-benzofuran-5-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide (PubChem CID 66807189) has the molecular formula C29H31N5O2S and a molecular weight of 513.67 g/mol. Its IUPAC name is N-[(3R)-1-(1-benzothiophen-3-ylmethyl)piperidin-3-yl]-3-(2,3-dihydro-1-benzofuran-5-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide.
| Compound Name | N-[(3R)-1-(1-benzothiophen-3-ylmethyl)piperidin-3-yl]-3-(2,3-dihydro-1-benzofuran-5-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 66807189 |
| Molecular Formula | C29H31N5O2S |
| Molecular Weight | 513.67 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | N-[(3R)-1-(1-benzothiophen-3-ylmethyl)piperidin-3-yl]-3-(2,3-dihydro-1-benzofuran-5-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide |
| SMILES | O=C(N[C@@H]1CCCN(Cc2csc3ccccc23)C1)N1CCc2[nH]nc(-c3ccc4c(c3)CCO4)c2C1 |
| InChI | InChI=1S/C29H31N5O2S/c35-29(30-22-4-3-11-33(16-22)15-21-18-37-27-6-2-1-5-23(21)27)34-12-9-25-24(17-34)28(32-31-25)20-7-8-26-19(14-20)10-13-36-26/h1-2,5-8,14,18,22H,3-4,9-13,15-17H2,(H,30,35)(H,31,32)/t22-/m1/s1 |
| InChIKey | YWPJVIYADAEFBY-JOCHJYFZSA-N |
| XLogP | 4.96 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.67 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |