About (3S)-3-cyclohexa-1,3-dien-1-ylpyrrolidine
(3S)-3-cyclohexa-1,3-dien-1-ylpyrrolidine (PubChem CID 66807240) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is (3S)-3-cyclohexa-1,3-dien-1-ylpyrrolidine.
Molecular Properties
| Compound Name | (3S)-3-cyclohexa-1,3-dien-1-ylpyrrolidine |
| PubChem CID | 66807240 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (3S)-3-cyclohexa-1,3-dien-1-ylpyrrolidine |
| SMILES | C1=CCCC([C@@H]2CCNC2)=C1 |
| InChI | InChI=1S/C10H15N/c1-2-4-9(5-3-1)10-6-7-11-8-10/h1-2,4,10-11H,3,5-8H2/t10-/m1/s1 |
| InChIKey | ZZDQQRQXHJPEEP-SNVBAGLBSA-N |
| XLogP | 1.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S)-3-cyclohexa-1,3-dien-1-ylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-cyclohexa-1,3-dien-1-ylpyrrolidine?
The IUPAC name of (3S)-3-cyclohexa-1,3-dien-1-ylpyrrolidine (CID 66807240) is (3S)-3-cyclohexa-1,3-dien-1-ylpyrrolidine.
What is the SMILES notation for (3S)-3-cyclohexa-1,3-dien-1-ylpyrrolidine?
The canonical SMILES for (3S)-3-cyclohexa-1,3-dien-1-ylpyrrolidine is C1=CCCC([C@@H]2CCNC2)=C1.
What is the InChIKey of (3S)-3-cyclohexa-1,3-dien-1-ylpyrrolidine?
The InChIKey is ZZDQQRQXHJPEEP-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H15N/c1-2-4-9(5-3-1)10-6-7-11-8-10/h1-2,4,10-11H,3,5-8H2/t10-/m1/s1.
What are the key properties of (3S)-3-cyclohexa-1,3-dien-1-ylpyrrolidine?
(3S)-3-cyclohexa-1,3-dien-1-ylpyrrolidine has a molecular weight of 149.24 g/mol, XLogP of 1.87, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-cyclohexa-1,3-dien-1-ylpyrrolidine is sourced from PubChem (CID 66807240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).