C19H13F5N8O2 — CID 66807460
2-N-(2,5-difluorophenyl)-2-N-methyl-6-[5-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-1,2,4-oxadiazol-3-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 66807460) has the molecular formula C19H13F5N8O2 and a molecular weight of 480.36 g/mol. Its IUPAC name is 2-N-(2,5-difluorophenyl)-2-N-methyl-6-[5-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-1,2,4-oxadiazol-3-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(2,5-difluorophenyl)-2-N-methyl-6-[5-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-1,2,4-oxadiazol-3-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 66807460 |
| Molecular Formula | C19H13F5N8O2 |
| Molecular Weight | 480.36 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 2-N-(2,5-difluorophenyl)-2-N-methyl-6-[5-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-1,2,4-oxadiazol-3-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | CN(c1nc(N)nc(-c2noc(-c3ccc(OCC(F)(F)F)nc3)n2)n1)c1cc(F)ccc1F |
| InChI | InChI=1S/C19H13F5N8O2/c1-32(12-6-10(20)3-4-11(12)21)18-29-14(28-17(25)30-18)15-27-16(34-31-15)9-2-5-13(26-7-9)33-8-19(22,23)24/h2-7H,8H2,1H3,(H2,25,28,29,30) |
| InChIKey | WOFKTKQJRVUHNQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |