C24H21NO — CID 66807812
(2R)-2-amino-2-naphthalen-2-yl-1,1-diphenylethanol (PubChem CID 66807812) has the molecular formula C24H21NO and a molecular weight of 339.44 g/mol. Its IUPAC name is (2R)-2-amino-2-naphthalen-2-yl-1,1-diphenylethanol.
| Compound Name | (2R)-2-amino-2-naphthalen-2-yl-1,1-diphenylethanol |
|---|---|
| PubChem CID | 66807812 |
| Molecular Formula | C24H21NO |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (2R)-2-amino-2-naphthalen-2-yl-1,1-diphenylethanol |
| SMILES | N[C@H](c1ccc2ccccc2c1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H21NO/c25-23(20-16-15-18-9-7-8-10-19(18)17-20)24(26,21-11-3-1-4-12-21)22-13-5-2-6-14-22/h1-17,23,26H,25H2/t23-/m1/s1 |
| InChIKey | UREUZEVMKVBZJV-HSZRJFAPSA-N |
| XLogP | 4.78 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |