C58H54N2O4 — CID 66807870
1-N,1-N'-bis[(1S)-2-benzyl-2-hydroxy-1-naphthalen-1-yl-3-phenylpropyl]cyclobutane-1,1-dicarboxamide (PubChem CID 66807870) has the molecular formula C58H54N2O4 and a molecular weight of 843.08 g/mol. Its IUPAC name is 1-N,1-N'-bis[(1S)-2-benzyl-2-hydroxy-1-naphthalen-1-yl-3-phenylpropyl]cyclobutane-1,1-dicarboxamide.
| Compound Name | 1-N,1-N'-bis[(1S)-2-benzyl-2-hydroxy-1-naphthalen-1-yl-3-phenylpropyl]cyclobutane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 66807870 |
| Molecular Formula | C58H54N2O4 |
| Molecular Weight | 843.08 g/mol |
| Exact Mass | 842.41 |
| IUPAC Name | 1-N,1-N'-bis[(1S)-2-benzyl-2-hydroxy-1-naphthalen-1-yl-3-phenylpropyl]cyclobutane-1,1-dicarboxamide |
| SMILES | O=C(N[C@@H](c1cccc2ccccc12)C(O)(Cc1ccccc1)Cc1ccccc1)C1(C(=O)N[C@@H](c2cccc3ccccc23)C(O)(Cc2ccccc2)Cc2ccccc2)CCC1 |
| InChI | InChI=1S/C58H54N2O4/c61-54(59-52(50-34-17-30-46-28-13-15-32-48(46)50)57(63,38-42-20-5-1-6-21-42)39-43-22-7-2-8-23-43)56(36-19-37-56)55(62)60-53(51-35-18-31-47-29-14-16-33-49(47)51)58(64,40-44-24-9-3-10-25-44)41-45-26-11-4-12-27-45/h1-18,20-35,52-53,63-64H,19,36-41H2,(H,59,61)(H,60,62)/t52-,53-/m0/s1 |
| InChIKey | WGXAHTJDQTVCHI-BNLBYEDMSA-N |
| XLogP | 10.61 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.08 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|