About pyrrolidine;trifluoromethanesulfonamide
pyrrolidine;trifluoromethanesulfonamide (PubChem CID 66808720) has the molecular formula C5H11F3N2O2S
and a molecular weight of 220.22 g/mol. Its IUPAC name is pyrrolidine;trifluoromethanesulfonamide.
Molecular Properties
| Compound Name | pyrrolidine;trifluoromethanesulfonamide |
| PubChem CID | 66808720 |
| Molecular Formula | C5H11F3N2O2S |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | pyrrolidine;trifluoromethanesulfonamide |
| SMILES | C1CCNC1.NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C4H9N.CH2F3NO2S/c1-2-4-5-3-1;2-1(3,4)8(5,6)7/h5H,1-4H2;(H2,5,6,7) |
| InChIKey | NADONWOEFPKFQJ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrrolidine;trifluoromethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidine;trifluoromethanesulfonamide?
The IUPAC name of pyrrolidine;trifluoromethanesulfonamide (CID 66808720) is pyrrolidine;trifluoromethanesulfonamide.
What is the SMILES notation for pyrrolidine;trifluoromethanesulfonamide?
The canonical SMILES for pyrrolidine;trifluoromethanesulfonamide is C1CCNC1.NS(=O)(=O)C(F)(F)F.
What is the InChIKey of pyrrolidine;trifluoromethanesulfonamide?
The InChIKey is NADONWOEFPKFQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N.CH2F3NO2S/c1-2-4-5-3-1;2-1(3,4)8(5,6)7/h5H,1-4H2;(H2,5,6,7).
What are the key properties of pyrrolidine;trifluoromethanesulfonamide?
pyrrolidine;trifluoromethanesulfonamide has a molecular weight of 220.22 g/mol, XLogP of 0.16, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidine;trifluoromethanesulfonamide is sourced from PubChem (CID 66808720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).